C20H38N2 — CID 6476772
N-cyclooctyl-N'-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]ethane-1,2-diamine (PubChem CID 6476772) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is N-cyclooctyl-N'-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]ethane-1,2-diamine.
| Compound Name | N-cyclooctyl-N'-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 6476772 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | N-cyclooctyl-N'-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]ethane-1,2-diamine |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1NCCNC1CCCCCCC1)C2(C)C |
| InChI | InChI=1S/C20H38N2/c1-15-18-13-16(20(18,2)3)14-19(15)22-12-11-21-17-9-7-5-4-6-8-10-17/h15-19,21-22H,4-14H2,1-3H3/t15-,16+,18-,19-/m1/s1 |
| InChIKey | AZJDBVFLIBJIPI-UKBAYJJMSA-N |
| XLogP | 4.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|