C12H13NO4S — CID 6476789
(E)-N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]-2-phenylethenesulfonamide (PubChem CID 6476789) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is (E)-N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]-2-phenylethenesulfonamide.
| Compound Name | (E)-N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 6476789 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | (E)-N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]-2-phenylethenesulfonamide |
| SMILES | C[C@@H]1OC(=O)[C@@H]1NS(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H13NO4S/c1-9-11(12(14)17-9)13-18(15,16)8-7-10-5-3-2-4-6-10/h2-9,11,13H,1H3/b8-7+/t9-,11+/m0/s1 |
| InChIKey | BGLIPSBQFBTQLZ-PRXIFDQHSA-N |
| XLogP | 0.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|