C20H22BrFN2O4 — CID 6476904
ethyl (E,4S)-4-[[(E)-3-(3-bromo-4-fluorophenyl)prop-2-enoyl]amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate (PubChem CID 6476904) has the molecular formula C20H22BrFN2O4 and a molecular weight of 453.31 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(E)-3-(3-bromo-4-fluorophenyl)prop-2-enoyl]amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[(E)-3-(3-bromo-4-fluorophenyl)prop-2-enoyl]amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate |
|---|---|
| PubChem CID | 6476904 |
| Molecular Formula | C20H22BrFN2O4 |
| Molecular Weight | 453.31 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | ethyl (E,4S)-4-[[(E)-3-(3-bromo-4-fluorophenyl)prop-2-enoyl]amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)/C=C/c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C20H22BrFN2O4/c1-2-28-19(26)8-5-15(12-14-9-10-23-20(14)27)24-18(25)7-4-13-3-6-17(22)16(21)11-13/h3-8,11,14-15H,2,9-10,12H2,1H3,(H,23,27)(H,24,25)/b7-4+,8-5+/t14-,15+/m0/s1 |
| InChIKey | CTSASDGCROCFDK-DZPAJJIOSA-N |
| XLogP | 2.73 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|