About 3-fluoro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline
3-fluoro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline (PubChem CID 64769072) has the molecular formula C10H10FN3S2
and a molecular weight of 255.34 g/mol. Its IUPAC name is 3-fluoro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline.
Molecular Properties
| Compound Name | 3-fluoro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline |
| PubChem CID | 64769072 |
| Molecular Formula | C10H10FN3S2 |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 3-fluoro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline |
| SMILES | Cc1nnc(SCc2ccc(N)cc2F)s1 |
| InChI | InChI=1S/C10H10FN3S2/c1-6-13-14-10(16-6)15-5-7-2-3-8(12)4-9(7)11/h2-4H,5,12H2,1H3 |
| InChIKey | BHXPGQHBWYPQLO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline?
The IUPAC name of 3-fluoro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline (CID 64769072) is 3-fluoro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline.
What is the SMILES notation for 3-fluoro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline?
The canonical SMILES for 3-fluoro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline is Cc1nnc(SCc2ccc(N)cc2F)s1.
What is the InChIKey of 3-fluoro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline?
The InChIKey is BHXPGQHBWYPQLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FN3S2/c1-6-13-14-10(16-6)15-5-7-2-3-8(12)4-9(7)11/h2-4H,5,12H2,1H3.
What are the key properties of 3-fluoro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline?
3-fluoro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline has a molecular weight of 255.34 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline is sourced from PubChem (CID 64769072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).