About [2-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorophenyl]methanamine
[2-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorophenyl]methanamine (PubChem CID 64769111) has the molecular formula C16H17FN2
and a molecular weight of 256.32 g/mol. Its IUPAC name is [2-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorophenyl]methanamine.
Molecular Properties
| Compound Name | [2-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorophenyl]methanamine |
| PubChem CID | 64769111 |
| Molecular Formula | C16H17FN2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | [2-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorophenyl]methanamine |
| SMILES | NCc1ccc(F)cc1CN1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H17FN2/c17-16-6-5-12(8-18)15(7-16)11-19-9-13-3-1-2-4-14(13)10-19/h1-7H,8-11,18H2 |
| InChIKey | MKDZAINGYNWOAU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorophenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorophenyl]methanamine?
The IUPAC name of [2-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorophenyl]methanamine (CID 64769111) is [2-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorophenyl]methanamine.
What is the SMILES notation for [2-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorophenyl]methanamine?
The canonical SMILES for [2-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorophenyl]methanamine is NCc1ccc(F)cc1CN1Cc2ccccc2C1.
What is the InChIKey of [2-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorophenyl]methanamine?
The InChIKey is MKDZAINGYNWOAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN2/c17-16-6-5-12(8-18)15(7-16)11-19-9-13-3-1-2-4-14(13)10-19/h1-7H,8-11,18H2.
What are the key properties of [2-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorophenyl]methanamine?
[2-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorophenyl]methanamine has a molecular weight of 256.32 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorophenyl]methanamine is sourced from PubChem (CID 64769111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).