C21H27FN4O5S — CID 647693
N'-[1-(4-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyethyl)-N-(1,3-thiazol-2-yl)butanediamide (PubChem CID 647693) has the molecular formula C21H27FN4O5S and a molecular weight of 466.54 g/mol. Its IUPAC name is N'-[1-(4-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyethyl)-N-(1,3-thiazol-2-yl)butanediamide.
| Compound Name | N'-[1-(4-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyethyl)-N-(1,3-thiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 647693 |
| Molecular Formula | C21H27FN4O5S |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | N'-[1-(4-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyethyl)-N-(1,3-thiazol-2-yl)butanediamide |
| SMILES | COCCNC(=O)C(c1ccc(F)cc1)N(CCOC)C(=O)CCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C21H27FN4O5S/c1-30-12-9-23-20(29)19(15-3-5-16(22)6-4-15)26(11-13-31-2)18(28)8-7-17(27)25-21-24-10-14-32-21/h3-6,10,14,19H,7-9,11-13H2,1-2H3,(H,23,29)(H,24,25,27) |
| InChIKey | DORXNFWZPTYMBY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|