About 1-[2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazol-4-yl]ethanone
1-[2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazol-4-yl]ethanone (PubChem CID 64770332) has the molecular formula C14H14FNOS
and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-[2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazol-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-[2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazol-4-yl]ethanone |
| PubChem CID | 64770332 |
| Molecular Formula | C14H14FNOS |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 1-[2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1csc(C(C)(C)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H14FNOS/c1-9(17)12-8-18-13(16-12)14(2,3)10-4-6-11(15)7-5-10/h4-8H,1-3H3 |
| InChIKey | NOYKWHXKJWERBG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazol-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazol-4-yl]ethanone?
The IUPAC name of 1-[2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazol-4-yl]ethanone (CID 64770332) is 1-[2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazol-4-yl]ethanone.
What is the SMILES notation for 1-[2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazol-4-yl]ethanone?
The canonical SMILES for 1-[2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazol-4-yl]ethanone is CC(=O)c1csc(C(C)(C)c2ccc(F)cc2)n1.
What is the InChIKey of 1-[2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazol-4-yl]ethanone?
The InChIKey is NOYKWHXKJWERBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FNOS/c1-9(17)12-8-18-13(16-12)14(2,3)10-4-6-11(15)7-5-10/h4-8H,1-3H3.
What are the key properties of 1-[2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazol-4-yl]ethanone?
1-[2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazol-4-yl]ethanone has a molecular weight of 263.34 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazol-4-yl]ethanone is sourced from PubChem (CID 64770332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).