C8H17NO5 — CID 6477160
(2R,3R,5S,6R)-2,6-bis(hydroxymethyl)-1-methylpiperidine-3,4,5-triol (PubChem CID 6477160) has the molecular formula C8H17NO5 and a molecular weight of 207.23 g/mol. Its IUPAC name is (2R,3R,5S,6R)-2,6-bis(hydroxymethyl)-1-methylpiperidine-3,4,5-triol.
| Compound Name | (2R,3R,5S,6R)-2,6-bis(hydroxymethyl)-1-methylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 6477160 |
| Molecular Formula | C8H17NO5 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | (2R,3R,5S,6R)-2,6-bis(hydroxymethyl)-1-methylpiperidine-3,4,5-triol |
| SMILES | CN1[C@H](CO)[C@H](O)C(O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C8H17NO5/c1-9-4(2-10)6(12)8(14)7(13)5(9)3-11/h4-8,10-14H,2-3H2,1H3/t4-,5-,6-,7+,8?/m1/s1 |
| InChIKey | CVSZHOAOIZMVHV-IYWGXSQHSA-N |
| XLogP | -3.26 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |