About 6-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine
6-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 647722) has the molecular formula C9H11N5
and a molecular weight of 189.22 g/mol. Its IUPAC name is 6-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine.
Analyze 6-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine?
The IUPAC name of 6-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine (CID 647722) is 6-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine.
What is the SMILES notation for 6-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine?
The canonical SMILES for 6-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine is c1cc2nncn2nc1N1CCCC1.
What is the InChIKey of 6-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine?
The InChIKey is CJJDVJQSWBFNGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5/c1-2-6-13(5-1)9-4-3-8-11-10-7-14(8)12-9/h3-4,7H,1-2,5-6H2.
What are the key properties of 6-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine?
6-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine has a molecular weight of 189.22 g/mol, XLogP of 0.72, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine is sourced from PubChem (CID 647722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).