About 2-(1-methyl-5-nitroimidazol-2-yl)-5-prop-2-ynylsulfanyl-1,3,4-thiadiazole
2-(1-methyl-5-nitroimidazol-2-yl)-5-prop-2-ynylsulfanyl-1,3,4-thiadiazole (PubChem CID 6477290) has the molecular formula C9H7N5O2S2
and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-(1-methyl-5-nitroimidazol-2-yl)-5-prop-2-ynylsulfanyl-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-(1-methyl-5-nitroimidazol-2-yl)-5-prop-2-ynylsulfanyl-1,3,4-thiadiazole |
| PubChem CID | 6477290 |
| Molecular Formula | C9H7N5O2S2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 2-(1-methyl-5-nitroimidazol-2-yl)-5-prop-2-ynylsulfanyl-1,3,4-thiadiazole |
| SMILES | C#CCSc1nnc(-c2ncc([N+](=O)[O-])n2C)s1 |
| InChI | InChI=1S/C9H7N5O2S2/c1-3-4-17-9-12-11-8(18-9)7-10-5-6(13(7)2)14(15)16/h1,5H,4H2,2H3 |
| InChIKey | VLVPKVKTKDOJNC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methyl-5-nitroimidazol-2-yl)-5-prop-2-ynylsulfanyl-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methyl-5-nitroimidazol-2-yl)-5-prop-2-ynylsulfanyl-1,3,4-thiadiazole?
The IUPAC name of 2-(1-methyl-5-nitroimidazol-2-yl)-5-prop-2-ynylsulfanyl-1,3,4-thiadiazole (CID 6477290) is 2-(1-methyl-5-nitroimidazol-2-yl)-5-prop-2-ynylsulfanyl-1,3,4-thiadiazole.
What is the SMILES notation for 2-(1-methyl-5-nitroimidazol-2-yl)-5-prop-2-ynylsulfanyl-1,3,4-thiadiazole?
The canonical SMILES for 2-(1-methyl-5-nitroimidazol-2-yl)-5-prop-2-ynylsulfanyl-1,3,4-thiadiazole is C#CCSc1nnc(-c2ncc([N+](=O)[O-])n2C)s1.
What is the InChIKey of 2-(1-methyl-5-nitroimidazol-2-yl)-5-prop-2-ynylsulfanyl-1,3,4-thiadiazole?
The InChIKey is VLVPKVKTKDOJNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N5O2S2/c1-3-4-17-9-12-11-8(18-9)7-10-5-6(13(7)2)14(15)16/h1,5H,4H2,2H3.
What are the key properties of 2-(1-methyl-5-nitroimidazol-2-yl)-5-prop-2-ynylsulfanyl-1,3,4-thiadiazole?
2-(1-methyl-5-nitroimidazol-2-yl)-5-prop-2-ynylsulfanyl-1,3,4-thiadiazole has a molecular weight of 281.32 g/mol, XLogP of 1.57, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-5-nitroimidazol-2-yl)-5-prop-2-ynylsulfanyl-1,3,4-thiadiazole is sourced from PubChem (CID 6477290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).