C31H33NO11 — CID 6477373
[(2R,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[2-oxo-3-phenoxy-4-[(E)-2-phenylethenyl]azetidin-1-yl]oxan-2-yl]methyl acetate (PubChem CID 6477373) has the molecular formula C31H33NO11 and a molecular weight of 595.60 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[2-oxo-3-phenoxy-4-[(E)-2-phenylethenyl]azetidin-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[2-oxo-3-phenoxy-4-[(E)-2-phenylethenyl]azetidin-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 6477373 |
| Molecular Formula | C31H33NO11 |
| Molecular Weight | 595.60 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[2-oxo-3-phenoxy-4-[(E)-2-phenylethenyl]azetidin-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](N2C(=O)C(Oc3ccccc3)C2/C=C/c2ccccc2)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H33NO11/c1-18(33)38-17-25-27(39-19(2)34)28(40-20(3)35)29(41-21(4)36)31(43-25)32-24(16-15-22-11-7-5-8-12-22)26(30(32)37)42-23-13-9-6-10-14-23/h5-16,24-29,31H,17H2,1-4H3/b16-15+/t24?,25-,26?,27-,28-,29-,31-/m1/s1 |
| InChIKey | MZAVUYIKPOMIAJ-RPZXDSIKSA-N |
| XLogP | 2.44 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.60 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|