C16H23Cl2N — CID 64774730
N-[2-(2,4-dichlorophenyl)ethyl]-2,4-dimethylcyclohexan-1-amine (PubChem CID 64774730) has the molecular formula C16H23Cl2N and a molecular weight of 300.27 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2,4-dimethylcyclohexan-1-amine.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2,4-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64774730 |
| Molecular Formula | C16H23Cl2N |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2,4-dimethylcyclohexan-1-amine |
| SMILES | CC1CCC(NCCc2ccc(Cl)cc2Cl)C(C)C1 |
| InChI | InChI=1S/C16H23Cl2N/c1-11-3-6-16(12(2)9-11)19-8-7-13-4-5-14(17)10-15(13)18/h4-5,10-12,16,19H,3,6-9H2,1-2H3 |
| InChIKey | VSUGNAXBPMDMPE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |