C16H26N6O7 — CID 6477570
(2S)-5-(diaminomethylideneamino)-2-[2-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]ethoxycarbonylamino]pentanoic acid (PubChem CID 6477570) has the molecular formula C16H26N6O7 and a molecular weight of 414.42 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[2-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]ethoxycarbonylamino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[2-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]ethoxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 6477570 |
| Molecular Formula | C16H26N6O7 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[2-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]ethoxycarbonylamino]pentanoic acid |
| SMILES | Cc1cn(CCOCCOC(=O)N[C@@H](CCCN=C(N)N)C(=O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H26N6O7/c1-10-9-22(15(26)21-12(10)23)5-6-28-7-8-29-16(27)20-11(13(24)25)3-2-4-19-14(17)18/h9,11H,2-8H2,1H3,(H,20,27)(H,24,25)(H4,17,18,19)(H,21,23,26)/t11-/m0/s1 |
| InChIKey | FAKZIUCYEWOIKQ-NSHDSACASA-N |
| XLogP | -1.91 |
| TPSA | 204.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|