C14H29N — CID 64776068
N,3,3-trimethyl-1-(4-methylcyclohexyl)butan-1-amine (PubChem CID 64776068) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is N,3,3-trimethyl-1-(4-methylcyclohexyl)butan-1-amine.
| Compound Name | N,3,3-trimethyl-1-(4-methylcyclohexyl)butan-1-amine |
|---|---|
| PubChem CID | 64776068 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | N,3,3-trimethyl-1-(4-methylcyclohexyl)butan-1-amine |
| SMILES | CNC(CC(C)(C)C)C1CCC(C)CC1 |
| InChI | InChI=1S/C14H29N/c1-11-6-8-12(9-7-11)13(15-5)10-14(2,3)4/h11-13,15H,6-10H2,1-5H3 |
| InChIKey | FTTLJZPHBOJFKL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |