C36H48N2O7 — CID 6477643
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(12E)-2-oxo-15-phenyl-1-oxa-3-azacyclopentadec-12-en-3-yl]-1-phenylbutan-2-yl]carbamate (PubChem CID 6477643) has the molecular formula C36H48N2O7 and a molecular weight of 620.79 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(12E)-2-oxo-15-phenyl-1-oxa-3-azacyclopentadec-12-en-3-yl]-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(12E)-2-oxo-15-phenyl-1-oxa-3-azacyclopentadec-12-en-3-yl]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 6477643 |
| Molecular Formula | C36H48N2O7 |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.35 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(12E)-2-oxo-15-phenyl-1-oxa-3-azacyclopentadec-12-en-3-yl]-1-phenylbutan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@H](O)CN1CCCCCCCC/C=C/CC(c2ccccc2)OC1=O)O[C@H]1CO[C@H]2OCC[C@H]21 |
| InChI | InChI=1S/C36H48N2O7/c39-31(30(24-27-16-10-8-11-17-27)37-35(40)44-33-26-43-34-29(33)21-23-42-34)25-38-22-15-7-5-3-1-2-4-6-14-20-32(45-36(38)41)28-18-12-9-13-19-28/h6,8-14,16-19,29-34,39H,1-5,7,15,20-26H2,(H,37,40)/b14-6+/t29-,30-,31+,32?,33-,34+/m0/s1 |
| InChIKey | FBXUJIUXHCKJLA-UNCCCOFISA-N |
| XLogP | 6.32 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|