C31H40N4O7 — CID 6477657
ethyl (E,4S)-7-amino-4-[[(2S)-3-cyclohexyl-2-[2-oxo-3-(phenylmethoxycarbonylamino)-1-pyridinyl]propanoyl]amino]-7-oxohept-2-enoate (PubChem CID 6477657) has the molecular formula C31H40N4O7 and a molecular weight of 580.68 g/mol. Its IUPAC name is ethyl (E,4S)-7-amino-4-[[(2S)-3-cyclohexyl-2-[2-oxo-3-(phenylmethoxycarbonylamino)-1-pyridinyl]propanoyl]amino]-7-oxohept-2-enoate.
| Compound Name | ethyl (E,4S)-7-amino-4-[[(2S)-3-cyclohexyl-2-[2-oxo-3-(phenylmethoxycarbonylamino)-1-pyridinyl]propanoyl]amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 6477657 |
| Molecular Formula | C31H40N4O7 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | ethyl (E,4S)-7-amino-4-[[(2S)-3-cyclohexyl-2-[2-oxo-3-(phenylmethoxycarbonylamino)-1-pyridinyl]propanoyl]amino]-7-oxohept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(N)=O)NC(=O)[C@H](CC1CCCCC1)n1cccc(NC(=O)OCc2ccccc2)c1=O |
| InChI | InChI=1S/C31H40N4O7/c1-2-41-28(37)18-16-24(15-17-27(32)36)33-29(38)26(20-22-10-5-3-6-11-22)35-19-9-14-25(30(35)39)34-31(40)42-21-23-12-7-4-8-13-23/h4,7-9,12-14,16,18-19,22,24,26H,2-3,5-6,10-11,15,17,20-21H2,1H3,(H2,32,36)(H,33,38)(H,34,40)/b18-16+/t24-,26-/m0/s1 |
| InChIKey | CFZGSSOHBJPZAD-HXAJWNEWSA-N |
| XLogP | 3.98 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|