C29H36N4O6 — CID 6477659
ethyl (E,4S)-7-amino-4-[[(2S)-2-[3-(cyclopentanecarbonylamino)-2-oxo-1-pyridinyl]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate (PubChem CID 6477659) has the molecular formula C29H36N4O6 and a molecular weight of 536.63 g/mol. Its IUPAC name is ethyl (E,4S)-7-amino-4-[[(2S)-2-[3-(cyclopentanecarbonylamino)-2-oxo-1-pyridinyl]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate.
| Compound Name | ethyl (E,4S)-7-amino-4-[[(2S)-2-[3-(cyclopentanecarbonylamino)-2-oxo-1-pyridinyl]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 6477659 |
| Molecular Formula | C29H36N4O6 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | ethyl (E,4S)-7-amino-4-[[(2S)-2-[3-(cyclopentanecarbonylamino)-2-oxo-1-pyridinyl]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(N)=O)NC(=O)[C@H](Cc1ccccc1)n1cccc(NC(=O)C2CCCC2)c1=O |
| InChI | InChI=1S/C29H36N4O6/c1-2-39-26(35)17-15-22(14-16-25(30)34)31-28(37)24(19-20-9-4-3-5-10-20)33-18-8-13-23(29(33)38)32-27(36)21-11-6-7-12-21/h3-5,8-10,13,15,17-18,21-22,24H,2,6-7,11-12,14,16,19H2,1H3,(H2,30,34)(H,31,37)(H,32,36)/b17-15+/t22-,24-/m0/s1 |
| InChIKey | IYFIVUYOONNQRY-DPAYKPLSSA-N |
| XLogP | 2.63 |
| TPSA | 149.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|