C14H23NOS — CID 64776643
1-(4-ethylcyclohexyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanol (PubChem CID 64776643) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is 1-(4-ethylcyclohexyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanol.
| Compound Name | 1-(4-ethylcyclohexyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanol |
|---|---|
| PubChem CID | 64776643 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-(4-ethylcyclohexyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanol |
| SMILES | CCC1CCC(C(O)Cc2csc(C)n2)CC1 |
| InChI | InChI=1S/C14H23NOS/c1-3-11-4-6-12(7-5-11)14(16)8-13-9-17-10(2)15-13/h9,11-12,14,16H,3-8H2,1-2H3 |
| InChIKey | DEOCNDIFIBAXRB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |