About [(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] hexanoate
[(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] hexanoate (PubChem CID 6477693) has the molecular formula C15H22N2O4
and a molecular weight of 294.35 g/mol. Its IUPAC name is [(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] hexanoate.
Molecular Properties
| Compound Name | [(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] hexanoate |
| PubChem CID | 6477693 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | [(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] hexanoate |
| SMILES | CCCCCC(=O)OC/C=C/Cn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H22N2O4/c1-3-4-5-8-13(18)21-10-7-6-9-17-11-12(2)14(19)16-15(17)20/h6-7,11H,3-5,8-10H2,1-2H3,(H,16,19,20)/b7-6+ |
| InChIKey | OJLHRPNMBHLQDD-VOTSOKGWSA-N |
| XLogP | 1.52 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] hexanoate?
The IUPAC name of [(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] hexanoate (CID 6477693) is [(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] hexanoate.
What is the SMILES notation for [(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] hexanoate?
The canonical SMILES for [(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] hexanoate is CCCCCC(=O)OC/C=C/Cn1cc(C)c(=O)[nH]c1=O.
What is the InChIKey of [(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] hexanoate?
The InChIKey is OJLHRPNMBHLQDD-VOTSOKGWSA-N. The full InChI is InChI=1S/C15H22N2O4/c1-3-4-5-8-13(18)21-10-7-6-9-17-11-12(2)14(19)16-15(17)20/h6-7,11H,3-5,8-10H2,1-2H3,(H,16,19,20)/b7-6+.
What are the key properties of [(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] hexanoate?
[(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] hexanoate has a molecular weight of 294.35 g/mol, XLogP of 1.52, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] hexanoate is sourced from PubChem (CID 6477693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).