C27H33N5O4 — CID 6477752
(E)-but-2-enedioic acid;N-(2,17-dimethyl-6,13,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaen-7-yl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 6477752) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-(2,17-dimethyl-6,13,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaen-7-yl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | (E)-but-2-enedioic acid;N-(2,17-dimethyl-6,13,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaen-7-yl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 6477752 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | (E)-but-2-enedioic acid;N-(2,17-dimethyl-6,13,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaen-7-yl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nccc2c(C)c3c(cc12)c1cnccc1n3C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H29N5.C4H4O4/c1-5-28(6-2)13-7-10-25-23-19-14-18-20-15-24-11-9-21(20)27(4)22(18)16(3)17(19)8-12-26-23;5-3(6)1-2-4(7)8/h8-9,11-12,14-15H,5-7,10,13H2,1-4H3,(H,25,26);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | YOCJURSAXXSETH-WLHGVMLRSA-N |
| XLogP | 4.44 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|