C15H24N4O2 — CID 64778325
5-ethyl-5-methyl-1-[(1-pentan-3-ylpyrazol-3-yl)methyl]imidazolidine-2,4-dione (PubChem CID 64778325) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 5-ethyl-5-methyl-1-[(1-pentan-3-ylpyrazol-3-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-ethyl-5-methyl-1-[(1-pentan-3-ylpyrazol-3-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 64778325 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 5-ethyl-5-methyl-1-[(1-pentan-3-ylpyrazol-3-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CCC(CC)n1ccc(CN2C(=O)NC(=O)C2(C)CC)n1 |
| InChI | InChI=1S/C15H24N4O2/c1-5-12(6-2)19-9-8-11(17-19)10-18-14(21)16-13(20)15(18,4)7-3/h8-9,12H,5-7,10H2,1-4H3,(H,16,20,21) |
| InChIKey | FDLLNRWHZLDYQX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|