C15H23N5 — CID 64779300
1-[1-[(1-cyclopentylpyrazol-3-yl)methyl]imidazol-2-yl]propan-2-amine (PubChem CID 64779300) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-[1-[(1-cyclopentylpyrazol-3-yl)methyl]imidazol-2-yl]propan-2-amine.
| Compound Name | 1-[1-[(1-cyclopentylpyrazol-3-yl)methyl]imidazol-2-yl]propan-2-amine |
|---|---|
| PubChem CID | 64779300 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 1-[1-[(1-cyclopentylpyrazol-3-yl)methyl]imidazol-2-yl]propan-2-amine |
| SMILES | CC(N)Cc1nccn1Cc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C15H23N5/c1-12(16)10-15-17-7-9-19(15)11-13-6-8-20(18-13)14-4-2-3-5-14/h6-9,12,14H,2-5,10-11,16H2,1H3 |
| InChIKey | FQZBSZCMZMGIKO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |