C16H24O2S — CID 6477954
3-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dimethylthiolane-2,4-dione (PubChem CID 6477954) has the molecular formula C16H24O2S and a molecular weight of 280.43 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dimethylthiolane-2,4-dione.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dimethylthiolane-2,4-dione |
|---|---|
| PubChem CID | 6477954 |
| Molecular Formula | C16H24O2S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dimethylthiolane-2,4-dione |
| SMILES | CC(C)=CCC/C(C)=C/CC1(C)C(=O)SC(C)C1=O |
| InChI | InChI=1S/C16H24O2S/c1-11(2)7-6-8-12(3)9-10-16(5)14(17)13(4)19-15(16)18/h7,9,13H,6,8,10H2,1-5H3/b12-9+ |
| InChIKey | VZRCGYDBODLBCW-FMIVXFBMSA-N |
| XLogP | 4.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|