About 5-[(3-carbamoylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid
5-[(3-carbamoylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 64779752) has the molecular formula C9H8N4O4
and a molecular weight of 236.19 g/mol. Its IUPAC name is 5-[(3-carbamoylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(3-carbamoylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 64779752 |
| Molecular Formula | C9H8N4O4 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 5-[(3-carbamoylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | NC(=O)c1ccn(Cc2cc(C(=O)O)no2)n1 |
| InChI | InChI=1S/C9H8N4O4/c10-8(14)6-1-2-13(11-6)4-5-3-7(9(15)16)12-17-5/h1-3H,4H2,(H2,10,14)(H,15,16) |
| InChIKey | YILNFWJWXZXULS-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(3-carbamoylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-carbamoylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-[(3-carbamoylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid (CID 64779752) is 5-[(3-carbamoylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-[(3-carbamoylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-[(3-carbamoylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid is NC(=O)c1ccn(Cc2cc(C(=O)O)no2)n1.
What is the InChIKey of 5-[(3-carbamoylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid?
The InChIKey is YILNFWJWXZXULS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O4/c10-8(14)6-1-2-13(11-6)4-5-3-7(9(15)16)12-17-5/h1-3H,4H2,(H2,10,14)(H,15,16).
What are the key properties of 5-[(3-carbamoylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid?
5-[(3-carbamoylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid has a molecular weight of 236.19 g/mol, XLogP of -0.28, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-carbamoylpyrazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 64779752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).