About 1-(6-amino-2-methyl-1,3-benzothiazol-5-yl)pyrazole-3-carboxamide
1-(6-amino-2-methyl-1,3-benzothiazol-5-yl)pyrazole-3-carboxamide (PubChem CID 64780541) has the molecular formula C12H11N5OS
and a molecular weight of 273.32 g/mol. Its IUPAC name is 1-(6-amino-2-methyl-1,3-benzothiazol-5-yl)pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-(6-amino-2-methyl-1,3-benzothiazol-5-yl)pyrazole-3-carboxamide |
| PubChem CID | 64780541 |
| Molecular Formula | C12H11N5OS |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 1-(6-amino-2-methyl-1,3-benzothiazol-5-yl)pyrazole-3-carboxamide |
| SMILES | Cc1nc2cc(-n3ccc(C(N)=O)n3)c(N)cc2s1 |
| InChI | InChI=1S/C12H11N5OS/c1-6-15-9-5-10(7(13)4-11(9)19-6)17-3-2-8(16-17)12(14)18/h2-5H,13H2,1H3,(H2,14,18) |
| InChIKey | HQJULNABICPEOG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-amino-2-methyl-1,3-benzothiazol-5-yl)pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-amino-2-methyl-1,3-benzothiazol-5-yl)pyrazole-3-carboxamide?
The IUPAC name of 1-(6-amino-2-methyl-1,3-benzothiazol-5-yl)pyrazole-3-carboxamide (CID 64780541) is 1-(6-amino-2-methyl-1,3-benzothiazol-5-yl)pyrazole-3-carboxamide.
What is the SMILES notation for 1-(6-amino-2-methyl-1,3-benzothiazol-5-yl)pyrazole-3-carboxamide?
The canonical SMILES for 1-(6-amino-2-methyl-1,3-benzothiazol-5-yl)pyrazole-3-carboxamide is Cc1nc2cc(-n3ccc(C(N)=O)n3)c(N)cc2s1.
What is the InChIKey of 1-(6-amino-2-methyl-1,3-benzothiazol-5-yl)pyrazole-3-carboxamide?
The InChIKey is HQJULNABICPEOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5OS/c1-6-15-9-5-10(7(13)4-11(9)19-6)17-3-2-8(16-17)12(14)18/h2-5H,13H2,1H3,(H2,14,18).
What are the key properties of 1-(6-amino-2-methyl-1,3-benzothiazol-5-yl)pyrazole-3-carboxamide?
1-(6-amino-2-methyl-1,3-benzothiazol-5-yl)pyrazole-3-carboxamide has a molecular weight of 273.32 g/mol, XLogP of 1.47, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-amino-2-methyl-1,3-benzothiazol-5-yl)pyrazole-3-carboxamide is sourced from PubChem (CID 64780541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).