About 1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]pyrazole-4-carboxamide
1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]pyrazole-4-carboxamide (PubChem CID 64780851) has the molecular formula C13H14N4O3
and a molecular weight of 274.28 g/mol. Its IUPAC name is 1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]pyrazole-4-carboxamide |
| PubChem CID | 64780851 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cnn(Cc2cc(N)cc3c2OCOC3)c1 |
| InChI | InChI=1S/C13H14N4O3/c14-11-1-8(12-9(2-11)6-19-7-20-12)4-17-5-10(3-16-17)13(15)18/h1-3,5H,4,6-7,14H2,(H2,15,18) |
| InChIKey | OMJNZLFRPPFPID-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]pyrazole-4-carboxamide?
The IUPAC name of 1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]pyrazole-4-carboxamide (CID 64780851) is 1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]pyrazole-4-carboxamide.
What is the SMILES notation for 1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]pyrazole-4-carboxamide?
The canonical SMILES for 1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]pyrazole-4-carboxamide is NC(=O)c1cnn(Cc2cc(N)cc3c2OCOC3)c1.
What is the InChIKey of 1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]pyrazole-4-carboxamide?
The InChIKey is OMJNZLFRPPFPID-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O3/c14-11-1-8(12-9(2-11)6-19-7-20-12)4-17-5-10(3-16-17)13(15)18/h1-3,5H,4,6-7,14H2,(H2,15,18).
What are the key properties of 1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]pyrazole-4-carboxamide?
1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]pyrazole-4-carboxamide has a molecular weight of 274.28 g/mol, XLogP of 0.48, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]pyrazole-4-carboxamide is sourced from PubChem (CID 64780851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).