About 2-piperazin-1-yl-1,3-benzoxazole
2-piperazin-1-yl-1,3-benzoxazole (PubChem CID 647818) has the molecular formula C11H13N3O
and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-piperazin-1-yl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-piperazin-1-yl-1,3-benzoxazole |
| PubChem CID | 647818 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-piperazin-1-yl-1,3-benzoxazole |
| SMILES | c1ccc2oc(N3CCNCC3)nc2c1 |
| InChI | InChI=1S/C11H13N3O/c1-2-4-10-9(3-1)13-11(15-10)14-7-5-12-6-8-14/h1-4,12H,5-8H2 |
| InChIKey | HLKHIJZYKGDCJM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperazin-1-yl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-yl-1,3-benzoxazole?
The IUPAC name of 2-piperazin-1-yl-1,3-benzoxazole (CID 647818) is 2-piperazin-1-yl-1,3-benzoxazole.
What is the SMILES notation for 2-piperazin-1-yl-1,3-benzoxazole?
The canonical SMILES for 2-piperazin-1-yl-1,3-benzoxazole is c1ccc2oc(N3CCNCC3)nc2c1.
What is the InChIKey of 2-piperazin-1-yl-1,3-benzoxazole?
The InChIKey is HLKHIJZYKGDCJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O/c1-2-4-10-9(3-1)13-11(15-10)14-7-5-12-6-8-14/h1-4,12H,5-8H2.
What are the key properties of 2-piperazin-1-yl-1,3-benzoxazole?
2-piperazin-1-yl-1,3-benzoxazole has a molecular weight of 203.25 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-yl-1,3-benzoxazole is sourced from PubChem (CID 647818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).