C14H15N5OS — CID 64782537
1-(3-carbamothioyl-5,6,7,8-tetrahydroquinolin-2-yl)pyrazole-4-carboxamide (PubChem CID 64782537) has the molecular formula C14H15N5OS and a molecular weight of 301.38 g/mol. Its IUPAC name is 1-(3-carbamothioyl-5,6,7,8-tetrahydroquinolin-2-yl)pyrazole-4-carboxamide.
| Compound Name | 1-(3-carbamothioyl-5,6,7,8-tetrahydroquinolin-2-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 64782537 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1-(3-carbamothioyl-5,6,7,8-tetrahydroquinolin-2-yl)pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cnn(-c2nc3c(cc2C(N)=S)CCCC3)c1 |
| InChI | InChI=1S/C14H15N5OS/c15-12(20)9-6-17-19(7-9)14-10(13(16)21)5-8-3-1-2-4-11(8)18-14/h5-7H,1-4H2,(H2,15,20)(H2,16,21) |
| InChIKey | VWNKMNNWQYRUKH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|