C15H12FNO3 — CID 64782580
N-(3-fluoro-4-hydroxyphenyl)-1,3-dihydro-2-benzofuran-5-carboxamide (PubChem CID 64782580) has the molecular formula C15H12FNO3 and a molecular weight of 273.26 g/mol. Its IUPAC name is N-(3-fluoro-4-hydroxyphenyl)-1,3-dihydro-2-benzofuran-5-carboxamide.
| Compound Name | N-(3-fluoro-4-hydroxyphenyl)-1,3-dihydro-2-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 64782580 |
| Molecular Formula | C15H12FNO3 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | N-(3-fluoro-4-hydroxyphenyl)-1,3-dihydro-2-benzofuran-5-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(F)c1)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C15H12FNO3/c16-13-6-12(3-4-14(13)18)17-15(19)9-1-2-10-7-20-8-11(10)5-9/h1-6,18H,7-8H2,(H,17,19) |
| InChIKey | IDNLYWCGBVVHSF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|