C12H13FN4O — CID 64782681
1-[2-fluoro-4-(methylaminomethyl)phenyl]pyrazole-3-carboxamide (PubChem CID 64782681) has the molecular formula C12H13FN4O and a molecular weight of 248.26 g/mol. Its IUPAC name is 1-[2-fluoro-4-(methylaminomethyl)phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[2-fluoro-4-(methylaminomethyl)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 64782681 |
| Molecular Formula | C12H13FN4O |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 1-[2-fluoro-4-(methylaminomethyl)phenyl]pyrazole-3-carboxamide |
| SMILES | CNCc1ccc(-n2ccc(C(N)=O)n2)c(F)c1 |
| InChI | InChI=1S/C12H13FN4O/c1-15-7-8-2-3-11(9(13)6-8)17-5-4-10(16-17)12(14)18/h2-6,15H,7H2,1H3,(H2,14,18) |
| InChIKey | JDEDNYOTFYSKPS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |