About 1-(6-amino-2,3-difluorophenyl)pyrazole-4-carboxamide
1-(6-amino-2,3-difluorophenyl)pyrazole-4-carboxamide (PubChem CID 64782710) has the molecular formula C10H8F2N4O
and a molecular weight of 238.20 g/mol. Its IUPAC name is 1-(6-amino-2,3-difluorophenyl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-(6-amino-2,3-difluorophenyl)pyrazole-4-carboxamide |
| PubChem CID | 64782710 |
| Molecular Formula | C10H8F2N4O |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1-(6-amino-2,3-difluorophenyl)pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cnn(-c2c(N)ccc(F)c2F)c1 |
| InChI | InChI=1S/C10H8F2N4O/c11-6-1-2-7(13)9(8(6)12)16-4-5(3-15-16)10(14)17/h1-4H,13H2,(H2,14,17) |
| InChIKey | VZAJAFBQZVGGBZ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-amino-2,3-difluorophenyl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-amino-2,3-difluorophenyl)pyrazole-4-carboxamide?
The IUPAC name of 1-(6-amino-2,3-difluorophenyl)pyrazole-4-carboxamide (CID 64782710) is 1-(6-amino-2,3-difluorophenyl)pyrazole-4-carboxamide.
What is the SMILES notation for 1-(6-amino-2,3-difluorophenyl)pyrazole-4-carboxamide?
The canonical SMILES for 1-(6-amino-2,3-difluorophenyl)pyrazole-4-carboxamide is NC(=O)c1cnn(-c2c(N)ccc(F)c2F)c1.
What is the InChIKey of 1-(6-amino-2,3-difluorophenyl)pyrazole-4-carboxamide?
The InChIKey is VZAJAFBQZVGGBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2N4O/c11-6-1-2-7(13)9(8(6)12)16-4-5(3-15-16)10(14)17/h1-4H,13H2,(H2,14,17).
What are the key properties of 1-(6-amino-2,3-difluorophenyl)pyrazole-4-carboxamide?
1-(6-amino-2,3-difluorophenyl)pyrazole-4-carboxamide has a molecular weight of 238.20 g/mol, XLogP of 0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-amino-2,3-difluorophenyl)pyrazole-4-carboxamide is sourced from PubChem (CID 64782710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).