C27H40N4O6S — CID 6478291
ethyl (E,4S)-7-amino-4-[[(2S)-2-[[(2S)-2-(ethylsulfanylcarbonylamino)-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate (PubChem CID 6478291) has the molecular formula C27H40N4O6S and a molecular weight of 548.71 g/mol. Its IUPAC name is ethyl (E,4S)-7-amino-4-[[(2S)-2-[[(2S)-2-(ethylsulfanylcarbonylamino)-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate.
| Compound Name | ethyl (E,4S)-7-amino-4-[[(2S)-2-[[(2S)-2-(ethylsulfanylcarbonylamino)-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 6478291 |
| Molecular Formula | C27H40N4O6S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | ethyl (E,4S)-7-amino-4-[[(2S)-2-[[(2S)-2-(ethylsulfanylcarbonylamino)-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(N)=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)SCC |
| InChI | InChI=1S/C27H40N4O6S/c1-5-37-24(33)15-13-20(12-14-23(28)32)29-25(34)22(17-19-10-8-7-9-11-19)30-26(35)21(16-18(3)4)31-27(36)38-6-2/h7-11,13,15,18,20-22H,5-6,12,14,16-17H2,1-4H3,(H2,28,32)(H,29,34)(H,30,35)(H,31,36)/b15-13+/t20-,21-,22-/m0/s1 |
| InChIKey | QMZHSGPRTLCOGB-JKCGXOLOSA-N |
| XLogP | 2.46 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|