C30H44N4O6S — CID 6478292
ethyl (E,4S)-7-amino-4-[[(2S)-2-[[(2S)-2-(cyclopentylsulfanylcarbonylamino)-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate (PubChem CID 6478292) has the molecular formula C30H44N4O6S and a molecular weight of 588.77 g/mol. Its IUPAC name is ethyl (E,4S)-7-amino-4-[[(2S)-2-[[(2S)-2-(cyclopentylsulfanylcarbonylamino)-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate.
| Compound Name | ethyl (E,4S)-7-amino-4-[[(2S)-2-[[(2S)-2-(cyclopentylsulfanylcarbonylamino)-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 6478292 |
| Molecular Formula | C30H44N4O6S |
| Molecular Weight | 588.77 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | ethyl (E,4S)-7-amino-4-[[(2S)-2-[[(2S)-2-(cyclopentylsulfanylcarbonylamino)-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(N)=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)SC1CCCC1 |
| InChI | InChI=1S/C30H44N4O6S/c1-4-40-27(36)17-15-22(14-16-26(31)35)32-28(37)25(19-21-10-6-5-7-11-21)33-29(38)24(18-20(2)3)34-30(39)41-23-12-8-9-13-23/h5-7,10-11,15,17,20,22-25H,4,8-9,12-14,16,18-19H2,1-3H3,(H2,31,35)(H,32,37)(H,33,38)(H,34,39)/b17-15+/t22-,24-,25-/m0/s1 |
| InChIKey | XOBWPCMQMSVYSJ-SHZDRPCSSA-N |
| XLogP | 3.38 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|