C15H26N2O2 — CID 64783123
4-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,2-dimethyloxan-4-ol (PubChem CID 64783123) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 4-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,2-dimethyloxan-4-ol.
| Compound Name | 4-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,2-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 64783123 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 4-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,2-dimethyloxan-4-ol |
| SMILES | CCC(C)n1ccc(CC2(O)CCOC(C)(C)C2)n1 |
| InChI | InChI=1S/C15H26N2O2/c1-5-12(2)17-8-6-13(16-17)10-15(18)7-9-19-14(3,4)11-15/h6,8,12,18H,5,7,9-11H2,1-4H3 |
| InChIKey | FEWZCCJGAULSDD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |