C12H23N3O — CID 64783227
3-[(1-pentan-3-ylpyrazol-3-yl)methoxy]propan-1-amine (PubChem CID 64783227) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 3-[(1-pentan-3-ylpyrazol-3-yl)methoxy]propan-1-amine.
| Compound Name | 3-[(1-pentan-3-ylpyrazol-3-yl)methoxy]propan-1-amine |
|---|---|
| PubChem CID | 64783227 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 3-[(1-pentan-3-ylpyrazol-3-yl)methoxy]propan-1-amine |
| SMILES | CCC(CC)n1ccc(COCCCN)n1 |
| InChI | InChI=1S/C12H23N3O/c1-3-12(4-2)15-8-6-11(14-15)10-16-9-5-7-13/h6,8,12H,3-5,7,9-10,13H2,1-2H3 |
| InChIKey | SPYCKIWJWLBPDE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|