C17H25N3S — CID 64783953
N-[2-(1-cyclopentylpyrazol-3-yl)-1-thiophen-3-ylethyl]propan-1-amine (PubChem CID 64783953) has the molecular formula C17H25N3S and a molecular weight of 303.47 g/mol. Its IUPAC name is N-[2-(1-cyclopentylpyrazol-3-yl)-1-thiophen-3-ylethyl]propan-1-amine.
| Compound Name | N-[2-(1-cyclopentylpyrazol-3-yl)-1-thiophen-3-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 64783953 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | N-[2-(1-cyclopentylpyrazol-3-yl)-1-thiophen-3-ylethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccn(C2CCCC2)n1)c1ccsc1 |
| InChI | InChI=1S/C17H25N3S/c1-2-9-18-17(14-8-11-21-13-14)12-15-7-10-20(19-15)16-5-3-4-6-16/h7-8,10-11,13,16-18H,2-6,9,12H2,1H3 |
| InChIKey | DWJAMZBIWZFWOV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |