C8H11IN2OS — CID 64787196
2-[4-(iodomethyl)-1,3-thiazol-2-yl]-N,N-dimethylacetamide (PubChem CID 64787196) has the molecular formula C8H11IN2OS and a molecular weight of 310.16 g/mol. Its IUPAC name is 2-[4-(iodomethyl)-1,3-thiazol-2-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(iodomethyl)-1,3-thiazol-2-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 64787196 |
| Molecular Formula | C8H11IN2OS |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | 2-[4-(iodomethyl)-1,3-thiazol-2-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cc1nc(CI)cs1 |
| InChI | InChI=1S/C8H11IN2OS/c1-11(2)8(12)3-7-10-6(4-9)5-13-7/h5H,3-4H2,1-2H3 |
| InChIKey | LUQPFICNGDTRMU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|