C14H12BrClN2O2 — CID 64787688
4-bromo-N-(4-chloro-3-hydroxyphenyl)-1-cyclopropylpyrrole-2-carboxamide (PubChem CID 64787688) has the molecular formula C14H12BrClN2O2 and a molecular weight of 355.62 g/mol. Its IUPAC name is 4-bromo-N-(4-chloro-3-hydroxyphenyl)-1-cyclopropylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(4-chloro-3-hydroxyphenyl)-1-cyclopropylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 64787688 |
| Molecular Formula | C14H12BrClN2O2 |
| Molecular Weight | 355.62 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 4-bromo-N-(4-chloro-3-hydroxyphenyl)-1-cyclopropylpyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(O)c1)c1cc(Br)cn1C1CC1 |
| InChI | InChI=1S/C14H12BrClN2O2/c15-8-5-12(18(7-8)10-2-3-10)14(20)17-9-1-4-11(16)13(19)6-9/h1,4-7,10,19H,2-3H2,(H,17,20) |
| InChIKey | WZUXCCUFKDKWPP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |