About 6-(iodomethyl)-1,3-dimethylpyrimidine-2,4-dione
6-(iodomethyl)-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 64788549) has the molecular formula C7H9IN2O2
and a molecular weight of 280.07 g/mol. Its IUPAC name is 6-(iodomethyl)-1,3-dimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-(iodomethyl)-1,3-dimethylpyrimidine-2,4-dione |
| PubChem CID | 64788549 |
| Molecular Formula | C7H9IN2O2 |
| Molecular Weight | 280.07 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 6-(iodomethyl)-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(CI)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C7H9IN2O2/c1-9-5(4-8)3-6(11)10(2)7(9)12/h3H,4H2,1-2H3 |
| InChIKey | UPLBSJFULIPFQV-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.07 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-(iodomethyl)-1,3-dimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(iodomethyl)-1,3-dimethylpyrimidine-2,4-dione?
The IUPAC name of 6-(iodomethyl)-1,3-dimethylpyrimidine-2,4-dione (CID 64788549) is 6-(iodomethyl)-1,3-dimethylpyrimidine-2,4-dione.
What is the SMILES notation for 6-(iodomethyl)-1,3-dimethylpyrimidine-2,4-dione?
The canonical SMILES for 6-(iodomethyl)-1,3-dimethylpyrimidine-2,4-dione is Cn1c(CI)cc(=O)n(C)c1=O.
What is the InChIKey of 6-(iodomethyl)-1,3-dimethylpyrimidine-2,4-dione?
The InChIKey is UPLBSJFULIPFQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9IN2O2/c1-9-5(4-8)3-6(11)10(2)7(9)12/h3H,4H2,1-2H3.
What are the key properties of 6-(iodomethyl)-1,3-dimethylpyrimidine-2,4-dione?
6-(iodomethyl)-1,3-dimethylpyrimidine-2,4-dione has a molecular weight of 280.07 g/mol, XLogP of 0.02, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(iodomethyl)-1,3-dimethylpyrimidine-2,4-dione is sourced from PubChem (CID 64788549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).