About 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)propan-1-ol
2-amino-3-(2,2,6-trimethylmorpholin-4-yl)propan-1-ol (PubChem CID 64789370) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)propan-1-ol.
Molecular Properties
| Compound Name | 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)propan-1-ol |
| PubChem CID | 64789370 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)propan-1-ol |
| SMILES | CC1CN(CC(N)CO)CC(C)(C)O1 |
| InChI | InChI=1S/C10H22N2O2/c1-8-4-12(5-9(11)6-13)7-10(2,3)14-8/h8-9,13H,4-7,11H2,1-3H3 |
| InChIKey | XKLGUFBYXDGLTL-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)propan-1-ol?
The IUPAC name of 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)propan-1-ol (CID 64789370) is 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)propan-1-ol.
What is the SMILES notation for 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)propan-1-ol?
The canonical SMILES for 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)propan-1-ol is CC1CN(CC(N)CO)CC(C)(C)O1.
What is the InChIKey of 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)propan-1-ol?
The InChIKey is XKLGUFBYXDGLTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O2/c1-8-4-12(5-9(11)6-13)7-10(2,3)14-8/h8-9,13H,4-7,11H2,1-3H3.
What are the key properties of 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)propan-1-ol?
2-amino-3-(2,2,6-trimethylmorpholin-4-yl)propan-1-ol has a molecular weight of 202.30 g/mol, XLogP of -0.19, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)propan-1-ol is sourced from PubChem (CID 64789370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).