C13H24N4O — CID 64789490
2-amino-6-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-methylhexan-1-ol (PubChem CID 64789490) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-amino-6-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-methylhexan-1-ol.
| Compound Name | 2-amino-6-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-methylhexan-1-ol |
|---|---|
| PubChem CID | 64789490 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 2-amino-6-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-methylhexan-1-ol |
| SMILES | CC(N)(CO)CCCCN1CCn2ccnc2C1 |
| InChI | InChI=1S/C13H24N4O/c1-13(14,11-18)4-2-3-6-16-8-9-17-7-5-15-12(17)10-16/h5,7,18H,2-4,6,8-11,14H2,1H3 |
| InChIKey | WBSVBTYWRKGYSP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|