C15H35N3O — CID 64790162
4-[2-(dimethylamino)ethyl-propylamino]-2-methyl-2-(propylamino)butan-1-ol (PubChem CID 64790162) has the molecular formula C15H35N3O and a molecular weight of 273.46 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl-propylamino]-2-methyl-2-(propylamino)butan-1-ol.
| Compound Name | 4-[2-(dimethylamino)ethyl-propylamino]-2-methyl-2-(propylamino)butan-1-ol |
|---|---|
| PubChem CID | 64790162 |
| Molecular Formula | C15H35N3O |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.28 |
| IUPAC Name | 4-[2-(dimethylamino)ethyl-propylamino]-2-methyl-2-(propylamino)butan-1-ol |
| SMILES | CCCNC(C)(CO)CCN(CCC)CCN(C)C |
| InChI | InChI=1S/C15H35N3O/c1-6-9-16-15(3,14-19)8-11-18(10-7-2)13-12-17(4)5/h16,19H,6-14H2,1-5H3 |
| InChIKey | PGTRMOBACREGDG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |