C17H28N2O2 — CID 64790992
3-[4-(methoxymethyl)piperidin-1-yl]-2-(methylamino)-2-phenylpropan-1-ol (PubChem CID 64790992) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 3-[4-(methoxymethyl)piperidin-1-yl]-2-(methylamino)-2-phenylpropan-1-ol.
| Compound Name | 3-[4-(methoxymethyl)piperidin-1-yl]-2-(methylamino)-2-phenylpropan-1-ol |
|---|---|
| PubChem CID | 64790992 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 3-[4-(methoxymethyl)piperidin-1-yl]-2-(methylamino)-2-phenylpropan-1-ol |
| SMILES | CNC(CO)(CN1CCC(COC)CC1)c1ccccc1 |
| InChI | InChI=1S/C17H28N2O2/c1-18-17(14-20,16-6-4-3-5-7-16)13-19-10-8-15(9-11-19)12-21-2/h3-7,15,18,20H,8-14H2,1-2H3 |
| InChIKey | RGEMVGUVCOXBRR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |