C15H26N2O — CID 64791132
4-(N,2-dimethylanilino)-2-(ethylamino)-2-methylbutan-1-ol (PubChem CID 64791132) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 4-(N,2-dimethylanilino)-2-(ethylamino)-2-methylbutan-1-ol.
| Compound Name | 4-(N,2-dimethylanilino)-2-(ethylamino)-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 64791132 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 4-(N,2-dimethylanilino)-2-(ethylamino)-2-methylbutan-1-ol |
| SMILES | CCNC(C)(CO)CCN(C)c1ccccc1C |
| InChI | InChI=1S/C15H26N2O/c1-5-16-15(3,12-18)10-11-17(4)14-9-7-6-8-13(14)2/h6-9,16,18H,5,10-12H2,1-4H3 |
| InChIKey | PBHFTJUZOSQYGQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |