C13H22N2O — CID 64791335
4-(N,2-dimethylanilino)-2-(methylamino)butan-1-ol (PubChem CID 64791335) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-(N,2-dimethylanilino)-2-(methylamino)butan-1-ol.
| Compound Name | 4-(N,2-dimethylanilino)-2-(methylamino)butan-1-ol |
|---|---|
| PubChem CID | 64791335 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 4-(N,2-dimethylanilino)-2-(methylamino)butan-1-ol |
| SMILES | CNC(CO)CCN(C)c1ccccc1C |
| InChI | InChI=1S/C13H22N2O/c1-11-6-4-5-7-13(11)15(3)9-8-12(10-16)14-2/h4-7,12,14,16H,8-10H2,1-3H3 |
| InChIKey | FTAYANFARCFOGW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |