C16H30N4O — CID 64791485
6-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-methyl-2-(propylamino)hexan-1-ol (PubChem CID 64791485) has the molecular formula C16H30N4O and a molecular weight of 294.44 g/mol. Its IUPAC name is 6-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-methyl-2-(propylamino)hexan-1-ol.
| Compound Name | 6-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-methyl-2-(propylamino)hexan-1-ol |
|---|---|
| PubChem CID | 64791485 |
| Molecular Formula | C16H30N4O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | 6-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-methyl-2-(propylamino)hexan-1-ol |
| SMILES | CCCNC(C)(CO)CCCCN1CCn2ccnc2C1 |
| InChI | InChI=1S/C16H30N4O/c1-3-7-18-16(2,14-21)6-4-5-9-19-11-12-20-10-8-17-15(20)13-19/h8,10,18,21H,3-7,9,11-14H2,1-2H3 |
| InChIKey | SDPOMYUYMMTQGU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|