About 4-[(E)-6-(3,4-dimethoxyphenyl)-3-ethylhex-3-enyl]heptane-3,5-dione
4-[(E)-6-(3,4-dimethoxyphenyl)-3-ethylhex-3-enyl]heptane-3,5-dione (PubChem CID 6479319) has the molecular formula C23H34O4
and a molecular weight of 374.52 g/mol. Its IUPAC name is 4-[(E)-6-(3,4-dimethoxyphenyl)-3-ethylhex-3-enyl]heptane-3,5-dione.
Molecular Properties
| Compound Name | 4-[(E)-6-(3,4-dimethoxyphenyl)-3-ethylhex-3-enyl]heptane-3,5-dione |
| PubChem CID | 6479319 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 4-[(E)-6-(3,4-dimethoxyphenyl)-3-ethylhex-3-enyl]heptane-3,5-dione |
| SMILES | CCC(=O)C(CC/C(=C/CCc1ccc(OC)c(OC)c1)CC)C(=O)CC |
| InChI | InChI=1S/C23H34O4/c1-6-17(12-14-19(20(24)7-2)21(25)8-3)10-9-11-18-13-15-22(26-4)23(16-18)27-5/h10,13,15-16,19H,6-9,11-12,14H2,1-5H3/b17-10+ |
| InChIKey | FVYKAELGRBCZNZ-LICLKQGHSA-N |
| XLogP | 5.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-6-(3,4-dimethoxyphenyl)-3-ethylhex-3-enyl]heptane-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-6-(3,4-dimethoxyphenyl)-3-ethylhex-3-enyl]heptane-3,5-dione?
The IUPAC name of 4-[(E)-6-(3,4-dimethoxyphenyl)-3-ethylhex-3-enyl]heptane-3,5-dione (CID 6479319) is 4-[(E)-6-(3,4-dimethoxyphenyl)-3-ethylhex-3-enyl]heptane-3,5-dione.
What is the SMILES notation for 4-[(E)-6-(3,4-dimethoxyphenyl)-3-ethylhex-3-enyl]heptane-3,5-dione?
The canonical SMILES for 4-[(E)-6-(3,4-dimethoxyphenyl)-3-ethylhex-3-enyl]heptane-3,5-dione is CCC(=O)C(CC/C(=C/CCc1ccc(OC)c(OC)c1)CC)C(=O)CC.
What is the InChIKey of 4-[(E)-6-(3,4-dimethoxyphenyl)-3-ethylhex-3-enyl]heptane-3,5-dione?
The InChIKey is FVYKAELGRBCZNZ-LICLKQGHSA-N. The full InChI is InChI=1S/C23H34O4/c1-6-17(12-14-19(20(24)7-2)21(25)8-3)10-9-11-18-13-15-22(26-4)23(16-18)27-5/h10,13,15-16,19H,6-9,11-12,14H2,1-5H3/b17-10+.
What are the key properties of 4-[(E)-6-(3,4-dimethoxyphenyl)-3-ethylhex-3-enyl]heptane-3,5-dione?
4-[(E)-6-(3,4-dimethoxyphenyl)-3-ethylhex-3-enyl]heptane-3,5-dione has a molecular weight of 374.52 g/mol, XLogP of 5.33, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-6-(3,4-dimethoxyphenyl)-3-ethylhex-3-enyl]heptane-3,5-dione is sourced from PubChem (CID 6479319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).