C17H12Cl4O — CID 6479336
(1E,4E)-1,5-bis(3,4-dichlorophenyl)penta-1,4-dien-3-ol (PubChem CID 6479336) has the molecular formula C17H12Cl4O and a molecular weight of 374.09 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(3,4-dichlorophenyl)penta-1,4-dien-3-ol.
| Compound Name | (1E,4E)-1,5-bis(3,4-dichlorophenyl)penta-1,4-dien-3-ol |
|---|---|
| PubChem CID | 6479336 |
| Molecular Formula | C17H12Cl4O |
| Molecular Weight | 374.09 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | (1E,4E)-1,5-bis(3,4-dichlorophenyl)penta-1,4-dien-3-ol |
| SMILES | OC(/C=C/c1ccc(Cl)c(Cl)c1)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H12Cl4O/c18-14-7-3-11(9-16(14)20)1-5-13(22)6-2-12-4-8-15(19)17(21)10-12/h1-10,13,22H/b5-1+,6-2+ |
| InChIKey | OZLGMZOJKCBDRF-IJIVKGSJSA-N |
| XLogP | 6.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.09 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |