C20H16Cl4O — CID 6479337
(2E,6E)-2,6-bis[(3,4-dichlorophenyl)methylidene]cyclohexan-1-ol (PubChem CID 6479337) has the molecular formula C20H16Cl4O and a molecular weight of 414.16 g/mol. Its IUPAC name is (2E,6E)-2,6-bis[(3,4-dichlorophenyl)methylidene]cyclohexan-1-ol.
| Compound Name | (2E,6E)-2,6-bis[(3,4-dichlorophenyl)methylidene]cyclohexan-1-ol |
|---|---|
| PubChem CID | 6479337 |
| Molecular Formula | C20H16Cl4O |
| Molecular Weight | 414.16 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | (2E,6E)-2,6-bis[(3,4-dichlorophenyl)methylidene]cyclohexan-1-ol |
| SMILES | OC1/C(=C/c2ccc(Cl)c(Cl)c2)CCC/C1=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H16Cl4O/c21-16-6-4-12(10-18(16)23)8-14-2-1-3-15(20(14)25)9-13-5-7-17(22)19(24)11-13/h4-11,20,25H,1-3H2/b14-8+,15-9+ |
| InChIKey | ISVZADKAGRVXHD-VOMDNODZSA-N |
| XLogP | 7.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.16 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |