C19H12Cl4OS — CID 6479339
(3Z,5Z)-3,5-bis[(3,4-dichlorophenyl)methylidene]thian-4-one (PubChem CID 6479339) has the molecular formula C19H12Cl4OS and a molecular weight of 430.18 g/mol. Its IUPAC name is (3Z,5Z)-3,5-bis[(3,4-dichlorophenyl)methylidene]thian-4-one.
| Compound Name | (3Z,5Z)-3,5-bis[(3,4-dichlorophenyl)methylidene]thian-4-one |
|---|---|
| PubChem CID | 6479339 |
| Molecular Formula | C19H12Cl4OS |
| Molecular Weight | 430.18 g/mol |
| Exact Mass | 427.94 |
| IUPAC Name | (3Z,5Z)-3,5-bis[(3,4-dichlorophenyl)methylidene]thian-4-one |
| SMILES | O=C1/C(=C/c2ccc(Cl)c(Cl)c2)CSC/C1=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H12Cl4OS/c20-15-3-1-11(7-17(15)22)5-13-9-25-10-14(19(13)24)6-12-2-4-16(21)18(23)8-12/h1-8H,9-10H2/b13-5+,14-6+ |
| InChIKey | FWWIOOPALCMIRN-ACFHMISVSA-N |
| XLogP | 7.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.18 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|